C21H24N4O2 — CID 45207187
(2-ethylmorpholin-4-yl)-[6-ethyl-2-(1H-pyrazol-4-yl)quinolin-4-yl]methanone (PubChem CID 45207187) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (2-ethylmorpholin-4-yl)-[6-ethyl-2-(1H-pyrazol-4-yl)quinolin-4-yl]methanone.
| Compound Name | (2-ethylmorpholin-4-yl)-[6-ethyl-2-(1H-pyrazol-4-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 45207187 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (2-ethylmorpholin-4-yl)-[6-ethyl-2-(1H-pyrazol-4-yl)quinolin-4-yl]methanone |
| SMILES | CCc1ccc2nc(-c3cn[nH]c3)cc(C(=O)N3CCOC(CC)C3)c2c1 |
| InChI | InChI=1S/C21H24N4O2/c1-3-14-5-6-19-17(9-14)18(10-20(24-19)15-11-22-23-12-15)21(26)25-7-8-27-16(4-2)13-25/h5-6,9-12,16H,3-4,7-8,13H2,1-2H3,(H,22,23) |
| InChIKey | KXLBXDSABGVIBA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |