C25H22N4O — CID 45209025
4-(4,5-diphenyl-1H-imidazol-2-yl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 45209025) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1H-imidazol-2-yl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one.
| Compound Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 45209025 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-1-(pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)CN1Cc1cccnc1 |
| InChI | InChI=1S/C25H22N4O/c30-22-14-21(17-29(22)16-18-8-7-13-26-15-18)25-27-23(19-9-3-1-4-10-19)24(28-25)20-11-5-2-6-12-20/h1-13,15,21H,14,16-17H2,(H,27,28) |
| InChIKey | DRAMROYGKORHCT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |