C19H24N6O — CID 45209928
[1-[[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol (PubChem CID 45209928) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is [1-[[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 45209928 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [1-[[1-[(4-pyrazol-1-ylphenyl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CC2CCCN(Cc3ccc(-n4cccn4)cc3)C2)nn1 |
| InChI | InChI=1S/C19H24N6O/c26-15-18-14-24(22-21-18)13-17-3-1-9-23(12-17)11-16-4-6-19(7-5-16)25-10-2-8-20-25/h2,4-8,10,14,17,26H,1,3,9,11-13,15H2 |
| InChIKey | FMEWFJCLIJMBID-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |