C13H17ClN6O — CID 45186762
[1-[[1-(6-chloropyridazin-3-yl)piperidin-3-yl]methyl]triazol-4-yl]methanol (PubChem CID 45186762) has the molecular formula C13H17ClN6O and a molecular weight of 308.77 g/mol. Its IUPAC name is [1-[[1-(6-chloropyridazin-3-yl)piperidin-3-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-(6-chloropyridazin-3-yl)piperidin-3-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 45186762 |
| Molecular Formula | C13H17ClN6O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [1-[[1-(6-chloropyridazin-3-yl)piperidin-3-yl]methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CC2CCCN(c3ccc(Cl)nn3)C2)nn1 |
| InChI | InChI=1S/C13H17ClN6O/c14-12-3-4-13(17-16-12)19-5-1-2-10(6-19)7-20-8-11(9-21)15-18-20/h3-4,8,10,21H,1-2,5-7,9H2 |
| InChIKey | BMBWVGBROAUXMW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |