C15H20N6O2 — CID 31125379
3-[1-[[(3S)-1-pyrazin-2-ylpiperidin-3-yl]methyl]triazol-4-yl]propanoic acid (PubChem CID 31125379) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-[1-[[(3S)-1-pyrazin-2-ylpiperidin-3-yl]methyl]triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[[(3S)-1-pyrazin-2-ylpiperidin-3-yl]methyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 31125379 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-[1-[[(3S)-1-pyrazin-2-ylpiperidin-3-yl]methyl]triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(C[C@H]2CCCN(c3cnccn3)C2)nn1 |
| InChI | InChI=1S/C15H20N6O2/c22-15(23)4-3-13-11-21(19-18-13)10-12-2-1-7-20(9-12)14-8-16-5-6-17-14/h5-6,8,11-12H,1-4,7,9-10H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | KKBMIAYSOMSWPJ-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |