C19H25N5O4 — CID 45214018
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide (PubChem CID 45214018) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45214018 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cn(CC2COc3ccccc3O2)nn1 |
| InChI | InChI=1S/C19H25N5O4/c25-19(20-6-3-7-23-8-10-26-11-9-23)16-13-24(22-21-16)12-15-14-27-17-4-1-2-5-18(17)28-15/h1-2,4-5,13,15H,3,6-12,14H2,(H,20,25) |
| InChIKey | CEMOXVYSERCSSH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|