C19H29N3O5 — CID 45215447
4-[[2-(2-hydroxy-3-morpholin-4-ylpropoxy)-3-methoxyphenyl]methyl]piperazin-2-one (PubChem CID 45215447) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[[2-(2-hydroxy-3-morpholin-4-ylpropoxy)-3-methoxyphenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[2-(2-hydroxy-3-morpholin-4-ylpropoxy)-3-methoxyphenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 45215447 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[[2-(2-hydroxy-3-morpholin-4-ylpropoxy)-3-methoxyphenyl]methyl]piperazin-2-one |
| SMILES | COc1cccc(CN2CCNC(=O)C2)c1OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C19H29N3O5/c1-25-17-4-2-3-15(11-22-6-5-20-18(24)13-22)19(17)27-14-16(23)12-21-7-9-26-10-8-21/h2-4,16,23H,5-14H2,1H3,(H,20,24) |
| InChIKey | LXTQGGMUSSHFKF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |