C22H31N3O4 — CID 45238896
1-[2-methoxy-6-[(2-pyridin-3-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 45238896) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[2-methoxy-6-[(2-pyridin-3-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[2-methoxy-6-[(2-pyridin-3-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 45238896 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-[2-methoxy-6-[(2-pyridin-3-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1cccc(CNCCc2cccnc2)c1OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C22H31N3O4/c1-27-21-6-2-5-19(15-24-9-7-18-4-3-8-23-14-18)22(21)29-17-20(26)16-25-10-12-28-13-11-25/h2-6,8,14,20,24,26H,7,9-13,15-17H2,1H3 |
| InChIKey | ABHQXNWHOWEZGU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|