C20H23ClN2O2S — CID 45215784
5-[1-(3-chlorobenzoyl)pyrrolidin-2-yl]-N,N-diethylthiophene-2-carboxamide (PubChem CID 45215784) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is 5-[1-(3-chlorobenzoyl)pyrrolidin-2-yl]-N,N-diethylthiophene-2-carboxamide.
| Compound Name | 5-[1-(3-chlorobenzoyl)pyrrolidin-2-yl]-N,N-diethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 45215784 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-[1-(3-chlorobenzoyl)pyrrolidin-2-yl]-N,N-diethylthiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2CCCN2C(=O)c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-3-22(4-2)20(25)18-11-10-17(26-18)16-9-6-12-23(16)19(24)14-7-5-8-15(21)13-14/h5,7-8,10-11,13,16H,3-4,6,9,12H2,1-2H3 |
| InChIKey | WWKIAZNUHAAVRD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |