C16H29N3O4S — CID 45217124
1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-(methoxymethyl)piperidine (PubChem CID 45217124) has the molecular formula C16H29N3O4S and a molecular weight of 359.49 g/mol. Its IUPAC name is 1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-(methoxymethyl)piperidine.
| Compound Name | 1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-(methoxymethyl)piperidine |
|---|---|
| PubChem CID | 45217124 |
| Molecular Formula | C16H29N3O4S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-(methoxymethyl)piperidine |
| SMILES | CCS(=O)(=O)c1ncc(CN2CCCC(COC)C2)n1CCOC |
| InChI | InChI=1S/C16H29N3O4S/c1-4-24(20,21)16-17-10-15(19(16)8-9-22-2)12-18-7-5-6-14(11-18)13-23-3/h10,14H,4-9,11-13H2,1-3H3 |
| InChIKey | KCDVVCXGDAOLRD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |