C22H32N4O2 — CID 45219743
1-(azepan-1-yl)-3-[3-[[methyl(pyrimidin-4-ylmethyl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 45219743) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[3-[[methyl(pyrimidin-4-ylmethyl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[3-[[methyl(pyrimidin-4-ylmethyl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45219743 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-(azepan-1-yl)-3-[3-[[methyl(pyrimidin-4-ylmethyl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | CN(Cc1cccc(OCC(O)CN2CCCCCC2)c1)Cc1ccncn1 |
| InChI | InChI=1S/C22H32N4O2/c1-25(15-20-9-10-23-18-24-20)14-19-7-6-8-22(13-19)28-17-21(27)16-26-11-4-2-3-5-12-26/h6-10,13,18,21,27H,2-5,11-12,14-17H2,1H3 |
| InChIKey | LBGQORPNKFFKJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |