C24H35N3O2 — CID 72930833
1-(azepan-1-yl)-3-[3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 72930833) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 72930833 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-(azepan-1-yl)-3-[3-[[methyl(2-pyridin-2-ylethyl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | CN(CCc1ccccn1)Cc1cccc(OCC(O)CN2CCCCCC2)c1 |
| InChI | InChI=1S/C24H35N3O2/c1-26(16-12-22-10-4-5-13-25-22)18-21-9-8-11-24(17-21)29-20-23(28)19-27-14-6-2-3-7-15-27/h4-5,8-11,13,17,23,28H,2-3,6-7,12,14-16,18-20H2,1H3 |
| InChIKey | NZTSMHLXVGISIW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |