C24H32N4O4 — CID 45220908
N-[1-[2-[(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)amino]-2-oxoethyl]pyrazol-4-yl]-3-(2-methoxyphenyl)propanamide (PubChem CID 45220908) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[1-[2-[(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)amino]-2-oxoethyl]pyrazol-4-yl]-3-(2-methoxyphenyl)propanamide.
| Compound Name | N-[1-[2-[(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)amino]-2-oxoethyl]pyrazol-4-yl]-3-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 45220908 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-[1-[2-[(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)amino]-2-oxoethyl]pyrazol-4-yl]-3-(2-methoxyphenyl)propanamide |
| SMILES | C=CCC(O)(CC=C)C(C)NC(=O)Cn1cc(NC(=O)CCc2ccccc2OC)cn1 |
| InChI | InChI=1S/C24H32N4O4/c1-5-13-24(31,14-6-2)18(3)26-23(30)17-28-16-20(15-25-28)27-22(29)12-11-19-9-7-8-10-21(19)32-4/h5-10,15-16,18,31H,1-2,11-14,17H2,3-4H3,(H,26,30)(H,27,29) |
| InChIKey | UGPUOYJIDBVRAT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|