C23H30N4O3S — CID 45221367
4-[[4-[2-[1-(1,3-thiazole-5-carbonyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde (PubChem CID 45221367) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-[[4-[2-[1-(1,3-thiazole-5-carbonyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[[4-[2-[1-(1,3-thiazole-5-carbonyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 45221367 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[[4-[2-[1-(1,3-thiazole-5-carbonyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(Cc2ccc(OCCC3CCCCN3C(=O)c3cncs3)cc2)CC1 |
| InChI | InChI=1S/C23H30N4O3S/c28-18-26-12-10-25(11-13-26)16-19-4-6-21(7-5-19)30-14-8-20-3-1-2-9-27(20)23(29)22-15-24-17-31-22/h4-7,15,17-18,20H,1-3,8-14,16H2 |
| InChIKey | FIPAACYQTRSARG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|