C26H39N3O3 — CID 26339706
4-[[4-[2-[(2S)-1-(2-cyclopentylacetyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde (PubChem CID 26339706) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-[[4-[2-[(2S)-1-(2-cyclopentylacetyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[[4-[2-[(2S)-1-(2-cyclopentylacetyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 26339706 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 4-[[4-[2-[(2S)-1-(2-cyclopentylacetyl)piperidin-2-yl]ethoxy]phenyl]methyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(Cc2ccc(OCC[C@@H]3CCCCN3C(=O)CC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H39N3O3/c30-21-28-16-14-27(15-17-28)20-23-8-10-25(11-9-23)32-18-12-24-7-3-4-13-29(24)26(31)19-22-5-1-2-6-22/h8-11,21-22,24H,1-7,12-20H2/t24-/m0/s1 |
| InChIKey | HYIOPMNWZRAEOW-DEOSSOPVSA-N |
| XLogP | 3.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|