C18H28N6OS — CID 45221934
3-[[4-(3-aminopentan-3-yl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide (PubChem CID 45221934) has the molecular formula C18H28N6OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 3-[[4-(3-aminopentan-3-yl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide.
| Compound Name | 3-[[4-(3-aminopentan-3-yl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 45221934 |
| Molecular Formula | C18H28N6OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-[[4-(3-aminopentan-3-yl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
| SMILES | CCC(N)(CC)c1cn(CC2CCCN(C(=O)Nc3ccsc3)C2)nn1 |
| InChI | InChI=1S/C18H28N6OS/c1-3-18(19,4-2)16-12-24(22-21-16)11-14-6-5-8-23(10-14)17(25)20-15-7-9-26-13-15/h7,9,12-14H,3-6,8,10-11,19H2,1-2H3,(H,20,25) |
| InChIKey | KQCDWKHLEZHLKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |