C17H19F2N3O3 — CID 45222170
3-[2-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate (PubChem CID 45222170) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is 3-[2-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-[2-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 45222170 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-[2-[3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate |
| SMILES | O=C(C[n+]1cc([O-])on1)N1CCCC(CCc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H19F2N3O3/c18-14-6-5-13(15(19)8-14)4-3-12-2-1-7-21(9-12)16(23)10-22-11-17(24)25-20-22/h5-6,8,11-12H,1-4,7,9-10H2 |
| InChIKey | GMQAIVQFPFAPTD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|