C20H27FN4O — CID 45222958
1-(6-fluoro-4-methylquinazolin-2-yl)-N-(oxan-4-yl)azepan-4-amine (PubChem CID 45222958) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-(6-fluoro-4-methylquinazolin-2-yl)-N-(oxan-4-yl)azepan-4-amine.
| Compound Name | 1-(6-fluoro-4-methylquinazolin-2-yl)-N-(oxan-4-yl)azepan-4-amine |
|---|---|
| PubChem CID | 45222958 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1-(6-fluoro-4-methylquinazolin-2-yl)-N-(oxan-4-yl)azepan-4-amine |
| SMILES | Cc1nc(N2CCCC(NC3CCOCC3)CC2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C20H27FN4O/c1-14-18-13-15(21)4-5-19(18)24-20(22-14)25-9-2-3-16(6-10-25)23-17-7-11-26-12-8-17/h4-5,13,16-17,23H,2-3,6-12H2,1H3 |
| InChIKey | IGWMMPXAKDIDLD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |