C31H40N4O4 — CID 45223446
ethyl 4-[[4-[[1-(2,3-dimethyl-1H-indole-7-carbonyl)piperidin-3-yl]methoxy]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 45223446) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is ethyl 4-[[4-[[1-(2,3-dimethyl-1H-indole-7-carbonyl)piperidin-3-yl]methoxy]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[[1-(2,3-dimethyl-1H-indole-7-carbonyl)piperidin-3-yl]methoxy]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45223446 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | ethyl 4-[[4-[[1-(2,3-dimethyl-1H-indole-7-carbonyl)piperidin-3-yl]methoxy]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccc(OCC3CCCN(C(=O)c4cccc5c(C)c(C)[nH]c45)C3)cc2)CC1 |
| InChI | InChI=1S/C31H40N4O4/c1-4-38-31(37)34-17-15-33(16-18-34)19-24-10-12-26(13-11-24)39-21-25-7-6-14-35(20-25)30(36)28-9-5-8-27-22(2)23(3)32-29(27)28/h5,8-13,25,32H,4,6-7,14-21H2,1-3H3 |
| InChIKey | AWDBWBHBJCSLJM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|