C20H32N4O — CID 45224307
1-[7,7-dimethyl-5-[[(E)-2-methylbut-2-enyl]amino]-6,8-dihydro-5H-quinazolin-2-yl]piperidin-4-ol (PubChem CID 45224307) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[7,7-dimethyl-5-[[(E)-2-methylbut-2-enyl]amino]-6,8-dihydro-5H-quinazolin-2-yl]piperidin-4-ol.
| Compound Name | 1-[7,7-dimethyl-5-[[(E)-2-methylbut-2-enyl]amino]-6,8-dihydro-5H-quinazolin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 45224307 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-[7,7-dimethyl-5-[[(E)-2-methylbut-2-enyl]amino]-6,8-dihydro-5H-quinazolin-2-yl]piperidin-4-ol |
| SMILES | C/C=C(\C)CNC1CC(C)(C)Cc2nc(N3CCC(O)CC3)ncc21 |
| InChI | InChI=1S/C20H32N4O/c1-5-14(2)12-21-17-10-20(3,4)11-18-16(17)13-22-19(23-18)24-8-6-15(25)7-9-24/h5,13,15,17,21,25H,6-12H2,1-4H3/b14-5+ |
| InChIKey | NTLXWIRSBSMSGZ-LHHJGKSTSA-N |
| XLogP | 3.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|