C17H23F3N2O3 — CID 45224430
5-[2-(2-methoxyethylamino)ethyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one (PubChem CID 45224430) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylamino)ethyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 5-[2-(2-methoxyethylamino)ethyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 45224430 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-[2-(2-methoxyethylamino)ethyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
| SMILES | COCCNCCC1CCC(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-24-11-10-21-9-8-14-4-7-16(23)22(14)12-13-2-5-15(6-3-13)25-17(18,19)20/h2-3,5-6,14,21H,4,7-12H2,1H3 |
| InChIKey | ZBZOQBDHWVLRQM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|