C29H33FN4O2 — CID 45228845
N-[1-[1-[(Z)-2-fluoro-3-phenylprop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,2,5-trimethylpyrazole-3-carboxamide (PubChem CID 45228845) has the molecular formula C29H33FN4O2 and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[1-[1-[(Z)-2-fluoro-3-phenylprop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,2,5-trimethylpyrazole-3-carboxamide.
| Compound Name | N-[1-[1-[(Z)-2-fluoro-3-phenylprop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,2,5-trimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 45228845 |
| Molecular Formula | C29H33FN4O2 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | N-[1-[1-[(Z)-2-fluoro-3-phenylprop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,2,5-trimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(Cc2ccccc2)C2CCN(C(=O)/C(F)=C/c3ccccc3)CC2)n(C)n1 |
| InChI | InChI=1S/C29H33FN4O2/c1-21-18-27(33(3)31-21)29(36)32(2)26(20-23-12-8-5-9-13-23)24-14-16-34(17-15-24)28(35)25(30)19-22-10-6-4-7-11-22/h4-13,18-19,24,26H,14-17,20H2,1-3H3/b25-19- |
| InChIKey | RACCTOJWTURFDE-PLRJNAJWSA-N |
| XLogP | 4.66 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|