C24H36ClN3O2 — CID 45231117
[4-chloro-2-[1-(1-ethylpiperidin-3-yl)piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 45231117) has the molecular formula C24H36ClN3O2 and a molecular weight of 434.02 g/mol. Its IUPAC name is [4-chloro-2-[1-(1-ethylpiperidin-3-yl)piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-chloro-2-[1-(1-ethylpiperidin-3-yl)piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 45231117 |
| Molecular Formula | C24H36ClN3O2 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [4-chloro-2-[1-(1-ethylpiperidin-3-yl)piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | CCN1CCCC(N2CCC(Oc3cc(Cl)ccc3C(=O)N3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C24H36ClN3O2/c1-2-26-12-6-7-20(18-26)27-15-10-21(11-16-27)30-23-17-19(25)8-9-22(23)24(29)28-13-4-3-5-14-28/h8-9,17,20-21H,2-7,10-16,18H2,1H3 |
| InChIKey | UUSXBMHOJNAKPE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |