C20H27ClN2O3 — CID 72873323
[5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 72873323) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is [5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | [5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 72873323 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1OC1CCN(C2CCCC2)CC1)N1CC(O)C1 |
| InChI | InChI=1S/C20H27ClN2O3/c21-14-5-6-19(18(11-14)20(25)23-12-16(24)13-23)26-17-7-9-22(10-8-17)15-3-1-2-4-15/h5-6,11,15-17,24H,1-4,7-10,12-13H2 |
| InChIKey | HAAJDZYUPOYPPI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |