C23H33ClN2O3 — CID 25279312
5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 25279312) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 25279312 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1cc(Cl)ccc1OC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H33ClN2O3/c24-16-5-10-22(21(15-16)23(28)25-17-6-8-19(27)9-7-17)29-20-11-13-26(14-12-20)18-3-1-2-4-18/h5,10,15,17-20,27H,1-4,6-9,11-14H2,(H,25,28) |
| InChIKey | CNYCOAVDEYEJSS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |