C18H24ClNO3 — CID 111778241
5-chloro-2-cyclopentyloxy-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 111778241) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 5-chloro-2-cyclopentyloxy-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 5-chloro-2-cyclopentyloxy-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 111778241 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5-chloro-2-cyclopentyloxy-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1cc(Cl)ccc1OC1CCCC1 |
| InChI | InChI=1S/C18H24ClNO3/c19-12-5-10-17(23-15-3-1-2-4-15)16(11-12)18(22)20-13-6-8-14(21)9-7-13/h5,10-11,13-15,21H,1-4,6-9H2,(H,20,22) |
| InChIKey | WOYOPYDECIKXRI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |