C14H16ClF2NO3 — CID 111744162
5-chloro-2-(difluoromethoxy)-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 111744162) has the molecular formula C14H16ClF2NO3 and a molecular weight of 319.73 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethoxy)-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 5-chloro-2-(difluoromethoxy)-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 111744162 |
| Molecular Formula | C14H16ClF2NO3 |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-chloro-2-(difluoromethoxy)-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C14H16ClF2NO3/c15-8-1-6-12(21-14(16)17)11(7-8)13(20)18-9-2-4-10(19)5-3-9/h1,6-7,9-10,14,19H,2-5H2,(H,18,20) |
| InChIKey | HLGPZAFDHLVFCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |