C24H35N3O4 — CID 45234542
1-[5-methoxy-2-[(2-phenoxyethylamino)methyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 45234542) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[5-methoxy-2-[(2-phenoxyethylamino)methyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[5-methoxy-2-[(2-phenoxyethylamino)methyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 45234542 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[5-methoxy-2-[(2-phenoxyethylamino)methyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | COc1ccc(CNCCOc2ccccc2)c(OCC(O)CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H35N3O4/c1-26-11-13-27(14-12-26)18-21(28)19-31-24-16-23(29-2)9-8-20(24)17-25-10-15-30-22-6-4-3-5-7-22/h3-9,16,21,25,28H,10-15,17-19H2,1-2H3 |
| InChIKey | JUGCECCGCCGMGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|