C19H27NO3 — CID 4523466
5-octyl-2-oxo-N-phenyloxolane-3-carboxamide (PubChem CID 4523466) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 5-octyl-2-oxo-N-phenyloxolane-3-carboxamide.
| Compound Name | 5-octyl-2-oxo-N-phenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 4523466 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 5-octyl-2-oxo-N-phenyloxolane-3-carboxamide |
| SMILES | CCCCCCCCC1CC(C(=O)Nc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H27NO3/c1-2-3-4-5-6-10-13-16-14-17(19(22)23-16)18(21)20-15-11-8-7-9-12-15/h7-9,11-12,16-17H,2-6,10,13-14H2,1H3,(H,20,21) |
| InChIKey | TVVDLGOCXOWACB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|