C20H25N5O — CID 45234763
[1-[[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-3-yl]methyl]triazol-4-yl]methanamine (PubChem CID 45234763) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is [1-[[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-3-yl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-3-yl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 45234763 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | [1-[[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-3-yl]methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(CC2CCCN(Cc3ccccc3-c3ccco3)C2)nn1 |
| InChI | InChI=1S/C20H25N5O/c21-11-18-15-25(23-22-18)13-16-5-3-9-24(12-16)14-17-6-1-2-7-19(17)20-8-4-10-26-20/h1-2,4,6-8,10,15-16H,3,5,9,11-14,21H2 |
| InChIKey | JVCIJLVMMKKFCB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |