C29H31N3O4 — CID 45236153
N-[[3-methoxy-4-(oxolan-3-yloxy)phenyl]methyl]-2,3-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-5-carboxamide (PubChem CID 45236153) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[[3-methoxy-4-(oxolan-3-yloxy)phenyl]methyl]-2,3-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-5-carboxamide.
| Compound Name | N-[[3-methoxy-4-(oxolan-3-yloxy)phenyl]methyl]-2,3-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 45236153 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[[3-methoxy-4-(oxolan-3-yloxy)phenyl]methyl]-2,3-dimethyl-N-(pyridin-3-ylmethyl)-1H-indole-5-carboxamide |
| SMILES | COc1cc(CN(Cc2cccnc2)C(=O)c2ccc3[nH]c(C)c(C)c3c2)ccc1OC1CCOC1 |
| InChI | InChI=1S/C29H31N3O4/c1-19-20(2)31-26-8-7-23(14-25(19)26)29(33)32(17-22-5-4-11-30-15-22)16-21-6-9-27(28(13-21)34-3)36-24-10-12-35-18-24/h4-9,11,13-15,24,31H,10,12,16-18H2,1-3H3 |
| InChIKey | RMPUHRJXIRCGTN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|