C17H20N2O2 — CID 4523660
N-(4,6-dimethyl-2-pyridinyl)-2-phenoxybutanamide (PubChem CID 4523660) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-2-phenoxybutanamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-2-phenoxybutanamide |
|---|---|
| PubChem CID | 4523660 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)Nc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C17H20N2O2/c1-4-15(21-14-8-6-5-7-9-14)17(20)19-16-11-12(2)10-13(3)18-16/h5-11,15H,4H2,1-3H3,(H,18,19,20) |
| InChIKey | XISXWPMOWZGFBX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |