C21H32N2O — CID 45236984
N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pent-4-enamide (PubChem CID 45236984) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pent-4-enamide.
| Compound Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pent-4-enamide |
|---|---|
| PubChem CID | 45236984 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC1CCCN(Cc2ccc(CC(C)C)cc2)C1 |
| InChI | InChI=1S/C21H32N2O/c1-4-5-8-21(24)22-20-7-6-13-23(16-20)15-19-11-9-18(10-12-19)14-17(2)3/h4,9-12,17,20H,1,5-8,13-16H2,2-3H3,(H,22,24) |
| InChIKey | UTTWHWLSYGDXBH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|