C20H29N4O3+ — CID 45238427
N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]-2-(5-oxo-2H-oxadiazol-3-ium-3-yl)acetamide (PubChem CID 45238427) has the molecular formula C20H29N4O3+ and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]-2-(5-oxo-2H-oxadiazol-3-ium-3-yl)acetamide.
| Compound Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]-2-(5-oxo-2H-oxadiazol-3-ium-3-yl)acetamide |
|---|---|
| PubChem CID | 45238427 |
| Molecular Formula | C20H29N4O3+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-3-yl]-2-(5-oxo-2H-oxadiazol-3-ium-3-yl)acetamide |
| SMILES | CC(C)Cc1ccc(CN2CCCC(NC(=O)C[n+]3cc(=O)o[nH]3)C2)cc1 |
| InChI | InChI=1S/C20H28N4O3/c1-15(2)10-16-5-7-17(8-6-16)11-23-9-3-4-18(12-23)21-19(25)13-24-14-20(26)27-22-24/h5-8,14-15,18H,3-4,9-13H2,1-2H3,(H-,21,22,25,26)/p+1 |
| InChIKey | WHGGVJQDEQYHQO-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|