C20H22FN3S — CID 45237664
1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]-N-[(3-methylsulfanylphenyl)methyl]ethanamine (PubChem CID 45237664) has the molecular formula C20H22FN3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]-N-[(3-methylsulfanylphenyl)methyl]ethanamine.
| Compound Name | 1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]-N-[(3-methylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 45237664 |
| Molecular Formula | C20H22FN3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-5-methylpyrazol-4-yl]-N-[(3-methylsulfanylphenyl)methyl]ethanamine |
| SMILES | CSc1cccc(CNC(C)c2cnn(-c3cccc(F)c3)c2C)c1 |
| InChI | InChI=1S/C20H22FN3S/c1-14(22-12-16-6-4-9-19(10-16)25-3)20-13-23-24(15(20)2)18-8-5-7-17(21)11-18/h4-11,13-14,22H,12H2,1-3H3 |
| InChIKey | CCVZNIOLKWRWQS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |