C20H21ClFNO2 — CID 45240656
(4-chlorophenyl)-[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 45240656) has the molecular formula C20H21ClFNO2 and a molecular weight of 361.84 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45240656 |
| Molecular Formula | C20H21ClFNO2 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (4-chlorophenyl)-[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC(CO)(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H21ClFNO2/c21-17-6-4-16(5-7-17)19(25)23-11-1-10-20(13-23,14-24)12-15-2-8-18(22)9-3-15/h2-9,24H,1,10-14H2 |
| InChIKey | LYTYOECXPLFSTR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |