C17H25N5O — CID 45240942
3-[[methyl-[[1-(piperidin-3-ylmethyl)triazol-4-yl]methyl]amino]methyl]phenol (PubChem CID 45240942) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[[methyl-[[1-(piperidin-3-ylmethyl)triazol-4-yl]methyl]amino]methyl]phenol.
| Compound Name | 3-[[methyl-[[1-(piperidin-3-ylmethyl)triazol-4-yl]methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 45240942 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 3-[[methyl-[[1-(piperidin-3-ylmethyl)triazol-4-yl]methyl]amino]methyl]phenol |
| SMILES | CN(Cc1cccc(O)c1)Cc1cn(CC2CCCNC2)nn1 |
| InChI | InChI=1S/C17H25N5O/c1-21(10-14-4-2-6-17(23)8-14)12-16-13-22(20-19-16)11-15-5-3-7-18-9-15/h2,4,6,8,13,15,18,23H,3,5,7,9-12H2,1H3 |
| InChIKey | IFIOCFGIWFENMB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |