C19H31N3O — CID 45241392
2-[1-(cyclohexylmethyl)-4-(pyridin-3-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 45241392) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-[1-(cyclohexylmethyl)-4-(pyridin-3-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[1-(cyclohexylmethyl)-4-(pyridin-3-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45241392 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 2-[1-(cyclohexylmethyl)-4-(pyridin-3-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(Cc2cccnc2)CCN1CC1CCCCC1 |
| InChI | InChI=1S/C19H31N3O/c23-12-8-19-16-21(14-18-7-4-9-20-13-18)10-11-22(19)15-17-5-2-1-3-6-17/h4,7,9,13,17,19,23H,1-3,5-6,8,10-12,14-16H2 |
| InChIKey | JHRHFCSJDUKGQO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |