C18H24N2O2S — CID 45243783
2-[4-[(E)-3-(furan-2-yl)prop-2-enyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol (PubChem CID 45243783) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[4-[(E)-3-(furan-2-yl)prop-2-enyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(E)-3-(furan-2-yl)prop-2-enyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45243783 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[4-[(E)-3-(furan-2-yl)prop-2-enyl]-1-(thiophen-2-ylmethyl)piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(C/C=C/c2ccco2)CCN1Cc1cccs1 |
| InChI | InChI=1S/C18H24N2O2S/c21-11-7-16-14-19(8-1-4-17-5-2-12-22-17)9-10-20(16)15-18-6-3-13-23-18/h1-6,12-13,16,21H,7-11,14-15H2/b4-1+ |
| InChIKey | CFZOFJZRXYLJJL-DAFODLJHSA-N |
| XLogP | 2.92 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |