C20H24F3N3O2 — CID 45244033
2-[2-[[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]amino]methyl]phenoxy]ethanol (PubChem CID 45244033) has the molecular formula C20H24F3N3O2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[2-[[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]amino]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]amino]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 45244033 |
| Molecular Formula | C20H24F3N3O2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[2-[[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]amino]methyl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1CNC1CCCN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C20H24F3N3O2/c21-20(22,23)16-7-8-19(25-13-16)26-9-3-5-17(14-26)24-12-15-4-1-2-6-18(15)28-11-10-27/h1-2,4,6-8,13,17,24,27H,3,5,9-12,14H2 |
| InChIKey | BHDMUWXRYOOSMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |