C17H24N4O3S — CID 45244313
5-methyl-4-(oxolan-3-ylamino)-N-(2-propan-2-yloxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 45244313) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 5-methyl-4-(oxolan-3-ylamino)-N-(2-propan-2-yloxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-4-(oxolan-3-ylamino)-N-(2-propan-2-yloxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 45244313 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 5-methyl-4-(oxolan-3-ylamino)-N-(2-propan-2-yloxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCOC(C)C)sc2ncnc(NC3CCOC3)c12 |
| InChI | InChI=1S/C17H24N4O3S/c1-10(2)24-7-5-18-16(22)14-11(3)13-15(19-9-20-17(13)25-14)21-12-4-6-23-8-12/h9-10,12H,4-8H2,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | TUYJQYHJFIJYDX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|