C19H22FNO2S — CID 45245353
1-[2-[(3-fluorophenyl)methyl]morpholin-4-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 45245353) has the molecular formula C19H22FNO2S and a molecular weight of 347.45 g/mol. Its IUPAC name is 1-[2-[(3-fluorophenyl)methyl]morpholin-4-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[2-[(3-fluorophenyl)methyl]morpholin-4-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 45245353 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[2-[(3-fluorophenyl)methyl]morpholin-4-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1CCOC(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H22FNO2S/c20-16-5-1-4-15(12-16)13-17-14-21(9-10-23-17)19(22)8-2-6-18-7-3-11-24-18/h1,3-5,7,11-12,17H,2,6,8-10,13-14H2 |
| InChIKey | FVRNNEWIBSVDTL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |