C18H30N4OS — CID 45250377
[1-[5-(3-methylsulfanylpropylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperidin-4-yl]methanol (PubChem CID 45250377) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is [1-[5-(3-methylsulfanylpropylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[5-(3-methylsulfanylpropylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 45250377 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [1-[5-(3-methylsulfanylpropylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperidin-4-yl]methanol |
| SMILES | CSCCCNC1CCCc2nc(N3CCC(CO)CC3)ncc21 |
| InChI | InChI=1S/C18H30N4OS/c1-24-11-3-8-19-16-4-2-5-17-15(16)12-20-18(21-17)22-9-6-14(13-23)7-10-22/h12,14,16,19,23H,2-11,13H2,1H3 |
| InChIKey | IIXBYMXXRDHBQC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|