C16H26N6O — CID 45250753
1-[1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol (PubChem CID 45250753) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 1-[1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 45250753 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-[1-[[1-[(3-ethylimidazol-4-yl)methyl]piperidin-4-yl]methyl]triazol-4-yl]ethanol |
| SMILES | CCn1cncc1CN1CCC(Cn2cc(C(C)O)nn2)CC1 |
| InChI | InChI=1S/C16H26N6O/c1-3-21-12-17-8-15(21)10-20-6-4-14(5-7-20)9-22-11-16(13(2)23)18-19-22/h8,11-14,23H,3-7,9-10H2,1-2H3 |
| InChIKey | HGLSBGDFBDVGJH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |