C15H22N6O3S — CID 45250995
N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide (PubChem CID 45250995) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 45250995 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide |
| SMILES | CCOCCc1nnc(NC(=O)N2CCCCC2c2nc(C)no2)s1 |
| InChI | InChI=1S/C15H22N6O3S/c1-3-23-9-7-12-18-19-14(25-12)17-15(22)21-8-5-4-6-11(21)13-16-10(2)20-24-13/h11H,3-9H2,1-2H3,(H,17,19,22) |
| InChIKey | ZMWHPWCECUQRFB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|