C14H20N6O2S2 — CID 91844203
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 91844203) has the molecular formula C14H20N6O2S2 and a molecular weight of 368.49 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 91844203 |
| Molecular Formula | C14H20N6O2S2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCCCC2c2nc(C)no2)s1 |
| InChI | InChI=1S/C14H20N6O2S2/c1-3-23-14-18-17-13(24-14)16-11(21)8-20-7-5-4-6-10(20)12-15-9(2)19-22-12/h10H,3-8H2,1-2H3,(H,16,17,21) |
| InChIKey | XKXUXSRCMBXRSK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|