C16H24N4O2 — CID 95136659
2-[(2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 95136659) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[(2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[(2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 95136659 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[(2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN1CCCC[C@@H]1c1nc(C)no1 |
| InChI | InChI=1S/C16H24N4O2/c1-4-9-19(10-5-2)15(21)12-20-11-7-6-8-14(20)16-17-13(3)18-22-16/h4-5,14H,1-2,6-12H2,3H3/t14-/m1/s1 |
| InChIKey | NMTYXMHFAFCSAJ-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|