C14H19N5OS3 — CID 91836265
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]acetamide (PubChem CID 91836265) has the molecular formula C14H19N5OS3 and a molecular weight of 369.54 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 91836265 |
| Molecular Formula | C14H19N5OS3 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN2CCCCC2c2nccs2)s1 |
| InChI | InChI=1S/C14H19N5OS3/c1-2-21-14-18-17-13(23-14)16-11(20)9-19-7-4-3-5-10(19)12-15-6-8-22-12/h6,8,10H,2-5,7,9H2,1H3,(H,16,17,20) |
| InChIKey | JECYOBFPBQNLNZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|