C12H17N5OS3 — CID 50949141
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetamide (PubChem CID 50949141) has the molecular formula C12H17N5OS3 and a molecular weight of 343.50 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 50949141 |
| Molecular Formula | C12H17N5OS3 |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN(C)C(C)c2nccs2)s1 |
| InChI | InChI=1S/C12H17N5OS3/c1-4-19-12-16-15-11(21-12)14-9(18)7-17(3)8(2)10-13-5-6-20-10/h5-6,8H,4,7H2,1-3H3,(H,14,15,18) |
| InChIKey | IMPULZZYMDHWEA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|