C13H19N5OS3 — CID 91836808
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]amino]acetamide (PubChem CID 91836808) has the molecular formula C13H19N5OS3 and a molecular weight of 357.53 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]amino]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 91836808 |
| Molecular Formula | C13H19N5OS3 |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]amino]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN(C)CCc2scnc2C)s1 |
| InChI | InChI=1S/C13H19N5OS3/c1-4-20-13-17-16-12(22-13)15-11(19)7-18(3)6-5-10-9(2)14-8-21-10/h8H,4-7H2,1-3H3,(H,15,16,19) |
| InChIKey | MSJJTGHDWJLRSX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|